What is the molar mass of aspirin C9H8O4?
180⋅g/mol.
What is the molar mass of aspirin C9H8O4 quizlet?
mg sample of aspirin, C9H8O4, (molar mass 180. g), is dissolved in enough water to produce 200. mL of solution.
How many moles of aspirin C9H8O4 contain 0.480 mol of O?
Solution for problem 4SC Chapter 6 Step-1Given:Moles of O = 0.480 mol O1 mol of C9H8O4 = 4 mol of OThus we can use the conversion factor, 0.480 mol of O = 0.480 mol of O = 0.12 mol of C9H8O4Thus 0.12 mol of aspirin, C9H8O4, contain 0.480 mole of O.
How many moles are in aspirin?
MOLES OF ELEMENTS IN A FORMULA For example, in a molecule of aspirin, C9H8O4, there are 9 carbon atoms, 8 hydrogen atoms and 4 oxygen atoms. compound. For example, one mole of aspirin contains 9 moles of carbon atoms, 8 moles of hydrogen atoms and 4 moles of oxygen atoms.
How many grams are in C9H8O4?
Answer and Explanation: The molecular weight of aspirin with a chemical formula for C9H8O4 is 180.157 grams per mole.
What is the percent composition of C9H8O4?
Results for: C9H8O4
| Element | Number | Percet Composition |
|---|---|---|
| H | 8 | 4.47574619823572 |
| O | 4 | 35.5253195613511 |
| C | 9 | 59.9989342404132 |
How many carbon atoms are present in 0.325 grams of aspirin c9h8o4?
Of the correct answer is 9.77 times 10 to the 21st carbon atoms. Thanks so much for watching.
What is the mass of 3.00 moles of cf2cl2?
The mass of 3.00 moles of CF2 Cl2 is 363 grams.
How can molar mass be calculated?
0:133:51How to Calculate Molar Mass (Molecular Weight) – YouTubeYouTube
How do I calculate moles?
The unit is denoted by mol.
- The formula for the number of moles formula is expressed as.
- Given.
- Number of moles formula is.
- Number of moles = Mass of substance / Mass of one mole.
- Number of moles = 95 / 86.94.
What is the formula of aspirin?
C₉H₈O₄Aspirin / Formula
How do you calculate molarity of aspirin?
Calculate the mass of aspirin in each tablet according to the equation below. (MW of aspirin = 180 g/mole) Moles of aspirin × Molecular Weight of aspirin (in g/mole) = Mass of aspirin (in grams) 7. Record the mass of aspirin in each tablet (as claimed on the bottle) in Table 3. 8.
What is C9H8O4?
Aspirin | C9H8O4 – PubChem.
What type of atom is C9H8O4?
Likewise, the molecular mass of an aspirin molecule, C9H8O4, is the sum of the atomic masses of nine carbon atoms, eight hydrogen atoms, and four oxygen atoms, which amounts to 180.15 amu (Figure 3.3).
What is the mass of aspirin?
180.158 g/molAspirin / Molar mass
What is the common name of C9H8O4?
Aspirin Aspirin | C9H8O4 – PubChem.
What is the molar mass of ccl2f2?
120.91 g/molDichlorodifluoromethane / Molar mass
How do you find the mass of 3 moles?
0:066:173. Mole and mass – YouTubeYouTube
How do you calculate moles from molar mass?
0:191:25Convert Molar Mass to Moles (2021) – YouTubeYouTube
What is meant by molar mass?
The molar mass/molecular weight is actually the sum of the total mass in grams of the atoms present to make up a molecule per mole. The unit of molar mass is grams/mole.
How do I find molar mass?
1:3011:20How To Calculate The Molar Mass of a Compound – Quick & Easy!YouTube
How do I calculate molecular mass?
Find the atomic mass for each element using the mass shown in the Periodic Table or Atomic Weight Table. Multiply the subscript (number of atoms) times that element's atomic mass and add the masses of all the elements in the molecule to obtain the molecular mass.
What substance is C9H8O4?
5-Acetylsalicylic acid 5-Acetylsalicylic acid | C9H8O4 – PubChem.
What is the chemical formula and the molecular weight of aspirin?
Aspirin acetylsalicylic acid
| PubChem CID | 23452462 |
|---|---|
| Structure | Find Similar Structures |
| Molecular Formula | C18H16O8 |
| Synonyms | aspirin acetylsalicylic acid SCHEMBL7580 |
| Molecular Weight | 360.3 |
What are the elements in C9H8O4?
Identification of Aspirin Chemical Compound
| Chemical Formula | C9H8O4 |
|---|---|
| Molecular Weight | 180.15742 g/mol |
| IUPAC Name | 2-(acetyloxy)benzoic acid |
| SMILES String | CC(=O)Oc1ccccc1C(O)=O |
| InChI | InChI=1S/C9H8O4/c1-6(10)13-8-5-3-2-4-7(8)9(11)12/h2-5H,1H3,(H,11,12) |
What is C9H8O4 used for?
Uses of Aspirin/Acetylsalicylic acid-(C9H8O4) It is used to prevent venous and arterial thrombosis. It is used in the treatment of different types of headaches. It is used as an anti-inflammatory agent for long-term as well as acute inflammation.
How many atoms does CCl2F2?
9.3 : Chemical Formulas and the Mole For example, in one mole of CCl2F2, there is 1 carbon atom, 2 chlorine atoms, and 2 fluorine atoms, which each contribute to the weight of the compound.
How do you determine molar mass?
0:133:51How to Calculate Molar Mass (Molecular Weight) – YouTubeYouTube
How do we calculate molar mass?
4:4911:20How To Calculate The Molar Mass of a Compound – Quick & Easy!YouTube
How do you calculate formula masses?
To calculate formula mass, multiply the subscript of each element in the formula by the element's atomic weight (relative atomic mass) found on the periodic table. The unit for formula mass is either u or Da (Daltons). The amu has been replaced with u, even though it is still commonly used.