What is the molar mass of C9H8O4?
180⋅g/mol.
How many grams are in C9H8O4?
Answer and Explanation: The molecular weight of aspirin with a chemical formula for C9H8O4 is 180.157 grams per mole.
How many atoms are in 1 mole of C9H8O4?
MOLES OF ELEMENTS IN A FORMULA For example, in a molecule of aspirin, C9H8O4, there are 9 carbon atoms, 8 hydrogen atoms and 4 oxygen atoms.
What is the mass percentage composition of C9H8O4?
Results for: C9H8O4
| Element | Number | Percet Composition |
|---|---|---|
| H | 8 | 4.47574619823572 |
| O | 4 | 35.5253195613511 |
| C | 9 | 59.9989342404132 |
What is C9H8O4?
Aspirin | C9H8O4 – PubChem.
What is the composition of oxygen in C9H8O4?
The model shows the molecular structure of chloroform. Likewise, the molecular mass of an aspirin molecule, C9H8O4, is the sum of the atomic masses of nine carbon atoms, eight hydrogen atoms, and four oxygen atoms, which amounts to 180.15 amu (Figure 3.3).
What type of atom is C9H8O4?
Likewise, the molecular mass of an aspirin molecule, C9H8O4, is the sum of the atomic masses of nine carbon atoms, eight hydrogen atoms, and four oxygen atoms, which amounts to 180.15 amu (Figure 3.3).
How do I find molar mass?
1:3011:20How To Calculate The Molar Mass of a Compound – Quick & Easy!YouTube
What are the elements in C9H8O4?
Identification of Aspirin Chemical Compound
| Chemical Formula | C9H8O4 |
|---|---|
| Molecular Weight | 180.15742 g/mol |
| IUPAC Name | 2-(acetyloxy)benzoic acid |
| SMILES String | CC(=O)Oc1ccccc1C(O)=O |
| InChI | InChI=1S/C9H8O4/c1-6(10)13-8-5-3-2-4-7(8)9(11)12/h2-5H,1H3,(H,11,12) |
What is C9H8O4 used for?
Uses of Aspirin/Acetylsalicylic acid-(C9H8O4) It is used to prevent venous and arterial thrombosis. It is used in the treatment of different types of headaches. It is used as an anti-inflammatory agent for long-term as well as acute inflammation.
How do I calculate moles?
How to find moles?
- Measure the weight of your substance.
- Use a periodic table to find its atomic or molecular mass.
- Divide the weight by the atomic or molecular mass.
- Check your results with Omni Calculator.
Sep 8, 2021
How do you find the molar mass step by step?
How to find the molar mass of a compound?
- Make use of the chemical formula to determine the number of atoms of each element in the compound.
- Multiply the atomic weight of each element with its number of atoms present in the compound.
- Add up all and assign unit as grams/mole.
- Example.
What substance is C9H8O4?
5-Acetylsalicylic acid 5-Acetylsalicylic acid | C9H8O4 – PubChem.
How do you find the molar mass on a calculator?
0:493:51How to Calculate Molar Mass (Molecular Weight) – YouTubeYouTube
What is the molar mass of aspirin C₉h₈o₄?
180.158 g/molAspirin / Molar mass
What type of compound is ch3 COOH?
Acetic acid , systematically named ethanoic acid , is an acidic, colourless liquid and organic compound with the chemical formula CH3COOH (also written as CH3CO2H, C2H4O2, or HC2H3O2).
How do you convert from grams to moles?
0:5213:17How To Convert Grams To Moles – VERY EASY! – YouTubeYouTube
What is the molar mass of aspirin C9H8O4 quizlet?
mg sample of aspirin, C9H8O4, (molar mass 180. g), is dissolved in enough water to produce 200. mL of solution.
What is the structure of CH3COOH?
CH₃COOHAcetic acid / Formula
What is the molar mass of CH3COOH?
60.052 g/molAcetic acid / Molar mass The molar mass of acetic acid is 60.052 g/mol. The acetic acid formula is CH3COOH and it is also known as Ethanoic acid.
How do you convert grams to molar mass?
1:224:56Converting Grams to Moles Using Molar Mass | How to Pass ChemistryYouTube
How many carbon atoms are present in 0.325 grams of aspirin c9h8o4?
Of the correct answer is 9.77 times 10 to the 21st carbon atoms. Thanks so much for watching.
What mass g of acetylsalicylic acid is present in the aspirin sample?
For the sample data, the mass of synthesized aspirin is 1.96 g. Corrected for purity, is: (1.96 × 0.75) = 1.47 g. The percent yield is: (1.47 g ÷ 2.63 g) × 100 = 55.9%….Part III Test of the Purity of the Synthesized Aspirin.
| Initial mass of aspirin sample (g) | 0.200 |
|---|---|
| Concentration of salicylic acid (mol/L) | 7.09 × 10–4 |
What is the hybridization of CH3COOH?
The hybridization of the carbon(C1) is Sp3 and carbon(C2) is Sp2. CH3COOH is the polar molecule in nature because of unequal distribution of charge on the atom that leads to some net dipole moment. Total 8 lone pairs electrons and 16 bonded pairs electrons present in CH3COOH Lewis structure.
What is CH3COOH formula?
CH₃COOHAcetic acid / Formula
How do I convert grams to moles?
0:5213:17How To Convert Grams To Moles – VERY EASY! – YouTubeYouTube
How many moles of aspirin C9H8O4 contain 0.480 mol of O?
Solution for problem 4SC Chapter 6 Step-1Given:Moles of O = 0.480 mol O1 mol of C9H8O4 = 4 mol of OThus we can use the conversion factor, 0.480 mol of O = 0.480 mol of O = 0.12 mol of C9H8O4Thus 0.12 mol of aspirin, C9H8O4, contain 0.480 mole of O.
How do you calculate moles of aspirin?
Multiply the number of each type of atom by its molecular weight and then sum the products. In the case of aspirin, the molecular weights of carbon, hydrogen and oxygen are 12.01, 1.01 and 16.00 amu, respectively. The molecular weight of aspirin is therefore 9(12.01) + 8(1.01) + 4(16.00) = 180.17 amu.
How do you find the theoretical mass of aspirin?
question 1
- Moles of Salicylic Acid = Moles of Aspirin —> 2 moles of Salicylic Acid makes 2 moles of Asprin.
- Molar Mass of Aspirin = 180.16 g.
- Theoretical yield of Aspirin (g) = (2 moles)(molar mass of aspirin) = 2.000(180.16) = 360.3 grams.
What is molar mass of CH3COOH?
60.052 g/molAcetic acid / Molar mass The molar mass of acetic acid is 60.052 g/mol. The acetic acid formula is CH3COOH and it is also known as Ethanoic acid.